C15H19ClN8O6S — CID 71687858
N-[2-[2-(6-amino-5-nitropyrimidin-4-yl)hydrazinyl]-2-oxoethyl]-4-(dimethylsulfamoyl)benzamide;hydrochloride (PubChem CID 71687858) has the molecular formula C15H19ClN8O6S and a molecular weight of 474.89 g/mol. Its IUPAC name is N-[2-[2-(6-amino-5-nitropyrimidin-4-yl)hydrazinyl]-2-oxoethyl]-4-(dimethylsulfamoyl)benzamide;hydrochloride.
| Compound Name | N-[2-[2-(6-amino-5-nitropyrimidin-4-yl)hydrazinyl]-2-oxoethyl]-4-(dimethylsulfamoyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 71687858 |
| Molecular Formula | C15H19ClN8O6S |
| Molecular Weight | 474.89 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | N-[2-[2-(6-amino-5-nitropyrimidin-4-yl)hydrazinyl]-2-oxoethyl]-4-(dimethylsulfamoyl)benzamide;hydrochloride |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)NCC(=O)NNc2ncnc(N)c2[N+](=O)[O-])cc1.Cl |
| InChI | InChI=1S/C15H18N8O6S.ClH/c1-22(2)30(28,29)10-5-3-9(4-6-10)15(25)17-7-11(24)20-21-14-12(23(26)27)13(16)18-8-19-14;/h3-6,8H,7H2,1-2H3,(H,17,25)(H,20,24)(H3,16,18,19,21);1H |
| InChIKey | RVODPFMUPIYKSV-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 202.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.89 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|