C9H14N6O3 — CID 80793356
2-[(6-amino-5-nitropyrimidin-4-yl)amino]-N-propan-2-ylacetamide (PubChem CID 80793356) has the molecular formula C9H14N6O3 and a molecular weight of 254.25 g/mol. Its IUPAC name is 2-[(6-amino-5-nitropyrimidin-4-yl)amino]-N-propan-2-ylacetamide.
| Compound Name | 2-[(6-amino-5-nitropyrimidin-4-yl)amino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 80793356 |
| Molecular Formula | C9H14N6O3 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-[(6-amino-5-nitropyrimidin-4-yl)amino]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CNc1ncnc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H14N6O3/c1-5(2)14-6(16)3-11-9-7(15(17)18)8(10)12-4-13-9/h4-5H,3H2,1-2H3,(H,14,16)(H3,10,11,12,13) |
| InChIKey | HWIHAEQTIJQWNO-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|