C7H11N7O3 — CID 83117408
2-[(6-amino-5-nitropyrimidin-4-yl)amino]ethylurea (PubChem CID 83117408) has the molecular formula C7H11N7O3 and a molecular weight of 241.21 g/mol. Its IUPAC name is 2-[(6-amino-5-nitropyrimidin-4-yl)amino]ethylurea.
| Compound Name | 2-[(6-amino-5-nitropyrimidin-4-yl)amino]ethylurea |
|---|---|
| PubChem CID | 83117408 |
| Molecular Formula | C7H11N7O3 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2-[(6-amino-5-nitropyrimidin-4-yl)amino]ethylurea |
| SMILES | NC(=O)NCCNc1ncnc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H11N7O3/c8-5-4(14(16)17)6(13-3-12-5)10-1-2-11-7(9)15/h3H,1-2H2,(H3,9,11,15)(H3,8,10,12,13) |
| InChIKey | UIZAATQAQULNAB-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 162.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|