C9H13N5O4 — CID 46705539
ethyl 3-[(6-amino-5-nitropyrimidin-4-yl)amino]propanoate (PubChem CID 46705539) has the molecular formula C9H13N5O4 and a molecular weight of 255.23 g/mol. Its IUPAC name is ethyl 3-[(6-amino-5-nitropyrimidin-4-yl)amino]propanoate.
| Compound Name | ethyl 3-[(6-amino-5-nitropyrimidin-4-yl)amino]propanoate |
|---|---|
| PubChem CID | 46705539 |
| Molecular Formula | C9H13N5O4 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | ethyl 3-[(6-amino-5-nitropyrimidin-4-yl)amino]propanoate |
| SMILES | CCOC(=O)CCNc1ncnc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H13N5O4/c1-2-18-6(15)3-4-11-9-7(14(16)17)8(10)12-5-13-9/h5H,2-4H2,1H3,(H3,10,11,12,13) |
| InChIKey | HKPKJKAFBULDDO-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|