C9H15N5O2 — CID 80798432
4-N-(2,2-dimethylpropyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 80798432) has the molecular formula C9H15N5O2 and a molecular weight of 225.25 g/mol. Its IUPAC name is 4-N-(2,2-dimethylpropyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-(2,2-dimethylpropyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80798432 |
| Molecular Formula | C9H15N5O2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 4-N-(2,2-dimethylpropyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | CC(C)(C)CNc1ncnc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H15N5O2/c1-9(2,3)4-11-8-6(14(15)16)7(10)12-5-13-8/h5H,4H2,1-3H3,(H3,10,11,12,13) |
| InChIKey | AVGXVWNCVSRDOC-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|