C8H10F3N5O3 — CID 80846201
5-nitro-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,6-diamine (PubChem CID 80846201) has the molecular formula C8H10F3N5O3 and a molecular weight of 281.19 g/mol. Its IUPAC name is 5-nitro-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,6-diamine.
| Compound Name | 5-nitro-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80846201 |
| Molecular Formula | C8H10F3N5O3 |
| Molecular Weight | 281.19 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 5-nitro-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,6-diamine |
| SMILES | Nc1ncnc(NCCOCC(F)(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H10F3N5O3/c9-8(10,11)3-19-2-1-13-7-5(16(17)18)6(12)14-4-15-7/h4H,1-3H2,(H3,12,13,14,15) |
| InChIKey | SXDYYUVIYQTHII-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.19 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|