C6H7F2N5O2 — CID 115409462
4-N-(2,2-difluoroethyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 115409462) has the molecular formula C6H7F2N5O2 and a molecular weight of 219.15 g/mol. Its IUPAC name is 4-N-(2,2-difluoroethyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-(2,2-difluoroethyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 115409462 |
| Molecular Formula | C6H7F2N5O2 |
| Molecular Weight | 219.15 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 4-N-(2,2-difluoroethyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | Nc1ncnc(NCC(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H7F2N5O2/c7-3(8)1-10-6-4(13(14)15)5(9)11-2-12-6/h2-3H,1H2,(H3,9,10,11,12) |
| InChIKey | BHLVNQFXOBYJCM-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.15 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|