C7H11N5O4S — CID 80791793
4-N-(2-methylsulfonylethyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 80791793) has the molecular formula C7H11N5O4S and a molecular weight of 261.26 g/mol. Its IUPAC name is 4-N-(2-methylsulfonylethyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-(2-methylsulfonylethyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80791793 |
| Molecular Formula | C7H11N5O4S |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 4-N-(2-methylsulfonylethyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | CS(=O)(=O)CCNc1ncnc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H11N5O4S/c1-17(15,16)3-2-9-7-5(12(13)14)6(8)10-4-11-7/h4H,2-3H2,1H3,(H3,8,9,10,11) |
| InChIKey | BGJLBCORPPSUSD-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|