C8H11ClN4O4S — CID 62100715
6-chloro-N-(3-methylsulfonylpropyl)-5-nitropyrimidin-4-amine (PubChem CID 62100715) has the molecular formula C8H11ClN4O4S and a molecular weight of 294.72 g/mol. Its IUPAC name is 6-chloro-N-(3-methylsulfonylpropyl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-chloro-N-(3-methylsulfonylpropyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 62100715 |
| Molecular Formula | C8H11ClN4O4S |
| Molecular Weight | 294.72 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 6-chloro-N-(3-methylsulfonylpropyl)-5-nitropyrimidin-4-amine |
| SMILES | CS(=O)(=O)CCCNc1ncnc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H11ClN4O4S/c1-18(16,17)4-2-3-10-8-6(13(14)15)7(9)11-5-12-8/h5H,2-4H2,1H3,(H,10,11,12) |
| InChIKey | MDSXCVZYGVVWBG-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.72 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|