C7H9ClN4O3 — CID 141342242
(2R)-1-[(6-chloro-5-nitropyrimidin-4-yl)amino]propan-2-ol (PubChem CID 141342242) has the molecular formula C7H9ClN4O3 and a molecular weight of 232.63 g/mol. Its IUPAC name is (2R)-1-[(6-chloro-5-nitropyrimidin-4-yl)amino]propan-2-ol.
| Compound Name | (2R)-1-[(6-chloro-5-nitropyrimidin-4-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 141342242 |
| Molecular Formula | C7H9ClN4O3 |
| Molecular Weight | 232.63 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | (2R)-1-[(6-chloro-5-nitropyrimidin-4-yl)amino]propan-2-ol |
| SMILES | C[C@@H](O)CNc1ncnc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H9ClN4O3/c1-4(13)2-9-7-5(12(14)15)6(8)10-3-11-7/h3-4,13H,2H2,1H3,(H,9,10,11)/t4-/m1/s1 |
| InChIKey | CEXCTVLIYVFPCN-SCSAIBSYSA-N |
| XLogP | 0.83 |
| TPSA | 101.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.63 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|