C11H17ClN4O3 — CID 107154935
1-[(6-chloro-5-nitropyrimidin-4-yl)amino]-4,4-dimethylpentan-2-ol (PubChem CID 107154935) has the molecular formula C11H17ClN4O3 and a molecular weight of 288.74 g/mol. Its IUPAC name is 1-[(6-chloro-5-nitropyrimidin-4-yl)amino]-4,4-dimethylpentan-2-ol.
| Compound Name | 1-[(6-chloro-5-nitropyrimidin-4-yl)amino]-4,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 107154935 |
| Molecular Formula | C11H17ClN4O3 |
| Molecular Weight | 288.74 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 1-[(6-chloro-5-nitropyrimidin-4-yl)amino]-4,4-dimethylpentan-2-ol |
| SMILES | CC(C)(C)CC(O)CNc1ncnc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H17ClN4O3/c1-11(2,3)4-7(17)5-13-10-8(16(18)19)9(12)14-6-15-10/h6-7,17H,4-5H2,1-3H3,(H,13,14,15) |
| InChIKey | QCFPOUVIANSYCM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 101.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.74 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|