C9H13ClN4O2S — CID 63959675
6-chloro-N-(2-methyl-3-methylsulfanylpropyl)-5-nitropyrimidin-4-amine (PubChem CID 63959675) has the molecular formula C9H13ClN4O2S and a molecular weight of 276.75 g/mol. Its IUPAC name is 6-chloro-N-(2-methyl-3-methylsulfanylpropyl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-chloro-N-(2-methyl-3-methylsulfanylpropyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 63959675 |
| Molecular Formula | C9H13ClN4O2S |
| Molecular Weight | 276.75 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 6-chloro-N-(2-methyl-3-methylsulfanylpropyl)-5-nitropyrimidin-4-amine |
| SMILES | CSCC(C)CNc1ncnc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H13ClN4O2S/c1-6(4-17-2)3-11-9-7(14(15)16)8(10)12-5-13-9/h5-6H,3-4H2,1-2H3,(H,11,12,13) |
| InChIKey | PAZRUNPWKSANJY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.75 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|