C9H11ClN4O2 — CID 106195915
6-chloro-5-nitro-N-[(E)-pent-3-enyl]pyrimidin-4-amine (PubChem CID 106195915) has the molecular formula C9H11ClN4O2 and a molecular weight of 242.67 g/mol. Its IUPAC name is 6-chloro-5-nitro-N-[(E)-pent-3-enyl]pyrimidin-4-amine.
| Compound Name | 6-chloro-5-nitro-N-[(E)-pent-3-enyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 106195915 |
| Molecular Formula | C9H11ClN4O2 |
| Molecular Weight | 242.67 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 6-chloro-5-nitro-N-[(E)-pent-3-enyl]pyrimidin-4-amine |
| SMILES | C/C=C/CCNc1ncnc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H11ClN4O2/c1-2-3-4-5-11-9-7(14(15)16)8(10)12-6-13-9/h2-3,6H,4-5H2,1H3,(H,11,12,13)/b3-2+ |
| InChIKey | OBGLTCUZIYKCCY-NSCUHMNNSA-N |
| XLogP | 2.42 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.67 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|