C10H12ClN5O3 — CID 79401733
3-[(6-chloro-5-nitropyrimidin-4-yl)amino]-N-cyclopropylpropanamide (PubChem CID 79401733) has the molecular formula C10H12ClN5O3 and a molecular weight of 285.69 g/mol. Its IUPAC name is 3-[(6-chloro-5-nitropyrimidin-4-yl)amino]-N-cyclopropylpropanamide.
| Compound Name | 3-[(6-chloro-5-nitropyrimidin-4-yl)amino]-N-cyclopropylpropanamide |
|---|---|
| PubChem CID | 79401733 |
| Molecular Formula | C10H12ClN5O3 |
| Molecular Weight | 285.69 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 3-[(6-chloro-5-nitropyrimidin-4-yl)amino]-N-cyclopropylpropanamide |
| SMILES | O=C(CCNc1ncnc(Cl)c1[N+](=O)[O-])NC1CC1 |
| InChI | InChI=1S/C10H12ClN5O3/c11-9-8(16(18)19)10(14-5-13-9)12-4-3-7(17)15-6-1-2-6/h5-6H,1-4H2,(H,15,17)(H,12,13,14) |
| InChIKey | JNNLBBZHSDSDOE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.69 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|