C11H18N6O — CID 80922661
N-cyclopropyl-3-[(6-hydrazinyl-5-methylpyrimidin-4-yl)amino]propanamide (PubChem CID 80922661) has the molecular formula C11H18N6O and a molecular weight of 250.31 g/mol. Its IUPAC name is N-cyclopropyl-3-[(6-hydrazinyl-5-methylpyrimidin-4-yl)amino]propanamide.
| Compound Name | N-cyclopropyl-3-[(6-hydrazinyl-5-methylpyrimidin-4-yl)amino]propanamide |
|---|---|
| PubChem CID | 80922661 |
| Molecular Formula | C11H18N6O |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | N-cyclopropyl-3-[(6-hydrazinyl-5-methylpyrimidin-4-yl)amino]propanamide |
| SMILES | Cc1c(NN)ncnc1NCCC(=O)NC1CC1 |
| InChI | InChI=1S/C11H18N6O/c1-7-10(14-6-15-11(7)17-12)13-5-4-9(18)16-8-2-3-8/h6,8H,2-5,12H2,1H3,(H,16,18)(H2,13,14,15,17) |
| InChIKey | WOJHMTOSHBWHTC-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|