C14H22N4O — CID 91648208
N-cyclopentyl-3-[(3,6-dimethylpyrazin-2-yl)amino]propanamide (PubChem CID 91648208) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is N-cyclopentyl-3-[(3,6-dimethylpyrazin-2-yl)amino]propanamide.
| Compound Name | N-cyclopentyl-3-[(3,6-dimethylpyrazin-2-yl)amino]propanamide |
|---|---|
| PubChem CID | 91648208 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | N-cyclopentyl-3-[(3,6-dimethylpyrazin-2-yl)amino]propanamide |
| SMILES | Cc1cnc(C)c(NCCC(=O)NC2CCCC2)n1 |
| InChI | InChI=1S/C14H22N4O/c1-10-9-16-11(2)14(17-10)15-8-7-13(19)18-12-5-3-4-6-12/h9,12H,3-8H2,1-2H3,(H,15,17)(H,18,19) |
| InChIKey | PTRYLUWOSNIEEM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |