About N-cycloheptyl-3,6-dimethylpyrazin-2-amine
N-cycloheptyl-3,6-dimethylpyrazin-2-amine (PubChem CID 60631763) has the molecular formula C13H21N3
and a molecular weight of 219.33 g/mol. Its IUPAC name is N-cycloheptyl-3,6-dimethylpyrazin-2-amine.
Molecular Properties
| Compound Name | N-cycloheptyl-3,6-dimethylpyrazin-2-amine |
| PubChem CID | 60631763 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | N-cycloheptyl-3,6-dimethylpyrazin-2-amine |
| SMILES | Cc1cnc(C)c(NC2CCCCCC2)n1 |
| InChI | InChI=1S/C13H21N3/c1-10-9-14-11(2)13(15-10)16-12-7-5-3-4-6-8-12/h9,12H,3-8H2,1-2H3,(H,15,16) |
| InChIKey | POVTWQIYCFKNHT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cycloheptyl-3,6-dimethylpyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cycloheptyl-3,6-dimethylpyrazin-2-amine?
The IUPAC name of N-cycloheptyl-3,6-dimethylpyrazin-2-amine (CID 60631763) is N-cycloheptyl-3,6-dimethylpyrazin-2-amine.
What is the SMILES notation for N-cycloheptyl-3,6-dimethylpyrazin-2-amine?
The canonical SMILES for N-cycloheptyl-3,6-dimethylpyrazin-2-amine is Cc1cnc(C)c(NC2CCCCCC2)n1.
What is the InChIKey of N-cycloheptyl-3,6-dimethylpyrazin-2-amine?
The InChIKey is POVTWQIYCFKNHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3/c1-10-9-14-11(2)13(15-10)16-12-7-5-3-4-6-8-12/h9,12H,3-8H2,1-2H3,(H,15,16).
What are the key properties of N-cycloheptyl-3,6-dimethylpyrazin-2-amine?
N-cycloheptyl-3,6-dimethylpyrazin-2-amine has a molecular weight of 219.33 g/mol, XLogP of 3.23, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cycloheptyl-3,6-dimethylpyrazin-2-amine is sourced from PubChem (CID 60631763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).