About (3R)-3-[(3,6-dimethylpyrazin-2-yl)amino]azepan-2-one
(3R)-3-[(3,6-dimethylpyrazin-2-yl)amino]azepan-2-one (PubChem CID 26458748) has the molecular formula C12H18N4O
and a molecular weight of 234.30 g/mol. Its IUPAC name is (3R)-3-[(3,6-dimethylpyrazin-2-yl)amino]azepan-2-one.
Molecular Properties
| Compound Name | (3R)-3-[(3,6-dimethylpyrazin-2-yl)amino]azepan-2-one |
| PubChem CID | 26458748 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | (3R)-3-[(3,6-dimethylpyrazin-2-yl)amino]azepan-2-one |
| SMILES | Cc1cnc(C)c(N[C@@H]2CCCCNC2=O)n1 |
| InChI | InChI=1S/C12H18N4O/c1-8-7-14-9(2)11(15-8)16-10-5-3-4-6-13-12(10)17/h7,10H,3-6H2,1-2H3,(H,13,17)(H,15,16)/t10-/m1/s1 |
| InChIKey | MQMLLCBILDEUNT-SNVBAGLBSA-N |
| XLogP | 1.17 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-3-[(3,6-dimethylpyrazin-2-yl)amino]azepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-[(3,6-dimethylpyrazin-2-yl)amino]azepan-2-one?
The IUPAC name of (3R)-3-[(3,6-dimethylpyrazin-2-yl)amino]azepan-2-one (CID 26458748) is (3R)-3-[(3,6-dimethylpyrazin-2-yl)amino]azepan-2-one.
What is the SMILES notation for (3R)-3-[(3,6-dimethylpyrazin-2-yl)amino]azepan-2-one?
The canonical SMILES for (3R)-3-[(3,6-dimethylpyrazin-2-yl)amino]azepan-2-one is Cc1cnc(C)c(N[C@@H]2CCCCNC2=O)n1.
What is the InChIKey of (3R)-3-[(3,6-dimethylpyrazin-2-yl)amino]azepan-2-one?
The InChIKey is MQMLLCBILDEUNT-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H18N4O/c1-8-7-14-9(2)11(15-8)16-10-5-3-4-6-13-12(10)17/h7,10H,3-6H2,1-2H3,(H,13,17)(H,15,16)/t10-/m1/s1.
What are the key properties of (3R)-3-[(3,6-dimethylpyrazin-2-yl)amino]azepan-2-one?
(3R)-3-[(3,6-dimethylpyrazin-2-yl)amino]azepan-2-one has a molecular weight of 234.30 g/mol, XLogP of 1.17, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-[(3,6-dimethylpyrazin-2-yl)amino]azepan-2-one is sourced from PubChem (CID 26458748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).