C12H19N3O — CID 65417548
N-(2-methoxycyclopentyl)-3,6-dimethylpyrazin-2-amine (PubChem CID 65417548) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is N-(2-methoxycyclopentyl)-3,6-dimethylpyrazin-2-amine.
| Compound Name | N-(2-methoxycyclopentyl)-3,6-dimethylpyrazin-2-amine |
|---|---|
| PubChem CID | 65417548 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | N-(2-methoxycyclopentyl)-3,6-dimethylpyrazin-2-amine |
| SMILES | COC1CCCC1Nc1nc(C)cnc1C |
| InChI | InChI=1S/C12H19N3O/c1-8-7-13-9(2)12(14-8)15-10-5-4-6-11(10)16-3/h7,10-11H,4-6H2,1-3H3,(H,14,15) |
| InChIKey | WSEZIRTYOHMADF-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |