C12H19N3 — CID 155572636
N-cyclohexyl-2,5-dimethylpyrimidin-4-amine (PubChem CID 155572636) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is N-cyclohexyl-2,5-dimethylpyrimidin-4-amine.
| Compound Name | N-cyclohexyl-2,5-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 155572636 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | N-cyclohexyl-2,5-dimethylpyrimidin-4-amine |
| SMILES | Cc1ncc(C)c(NC2CCCCC2)n1 |
| InChI | InChI=1S/C12H19N3/c1-9-8-13-10(2)14-12(9)15-11-6-4-3-5-7-11/h8,11H,3-7H2,1-2H3,(H,13,14,15) |
| InChIKey | UQGAQIAZTOQFKC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |