C12H18ClN3 — CID 63736474
6-chloro-N-cyclohexyl-2,5-dimethylpyrimidin-4-amine (PubChem CID 63736474) has the molecular formula C12H18ClN3 and a molecular weight of 239.75 g/mol. Its IUPAC name is 6-chloro-N-cyclohexyl-2,5-dimethylpyrimidin-4-amine.
| Compound Name | 6-chloro-N-cyclohexyl-2,5-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 63736474 |
| Molecular Formula | C12H18ClN3 |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 6-chloro-N-cyclohexyl-2,5-dimethylpyrimidin-4-amine |
| SMILES | Cc1nc(Cl)c(C)c(NC2CCCCC2)n1 |
| InChI | InChI=1S/C12H18ClN3/c1-8-11(13)14-9(2)15-12(8)16-10-6-4-3-5-7-10/h10H,3-7H2,1-2H3,(H,14,15,16) |
| InChIKey | VFRRWPHZZUBWNF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |