C11H17N3 — CID 130906121
N-cyclobutyl-2,5,6-trimethylpyrimidin-4-amine (PubChem CID 130906121) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is N-cyclobutyl-2,5,6-trimethylpyrimidin-4-amine.
| Compound Name | N-cyclobutyl-2,5,6-trimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 130906121 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | N-cyclobutyl-2,5,6-trimethylpyrimidin-4-amine |
| SMILES | Cc1nc(C)c(C)c(NC2CCC2)n1 |
| InChI | InChI=1S/C11H17N3/c1-7-8(2)12-9(3)13-11(7)14-10-5-4-6-10/h10H,4-6H2,1-3H3,(H,12,13,14) |
| InChIKey | KVGQZMKCDCDTFZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |