C16H18ClN3 — CID 71428128
6-chloro-N-cyclopentyl-2-methyl-5-phenylpyrimidin-4-amine (PubChem CID 71428128) has the molecular formula C16H18ClN3 and a molecular weight of 287.79 g/mol. Its IUPAC name is 6-chloro-N-cyclopentyl-2-methyl-5-phenylpyrimidin-4-amine.
| Compound Name | 6-chloro-N-cyclopentyl-2-methyl-5-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 71428128 |
| Molecular Formula | C16H18ClN3 |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 6-chloro-N-cyclopentyl-2-methyl-5-phenylpyrimidin-4-amine |
| SMILES | Cc1nc(Cl)c(-c2ccccc2)c(NC2CCCC2)n1 |
| InChI | InChI=1S/C16H18ClN3/c1-11-18-15(17)14(12-7-3-2-4-8-12)16(19-11)20-13-9-5-6-10-13/h2-4,7-8,13H,5-6,9-10H2,1H3,(H,18,19,20) |
| InChIKey | PWGWPBBSABRTPY-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |