C32H37ClN8O2 — CID 160793666
5-(4-aminophenyl)-N-cyclopentyl-2-methylpyrimidin-4-amine;6-chloro-N-cyclopentyl-2-methyl-5-(4-nitrophenyl)pyrimidin-4-amine (PubChem CID 160793666) has the molecular formula C32H37ClN8O2 and a molecular weight of 601.16 g/mol. Its IUPAC name is 5-(4-aminophenyl)-N-cyclopentyl-2-methylpyrimidin-4-amine;6-chloro-N-cyclopentyl-2-methyl-5-(4-nitrophenyl)pyrimidin-4-amine.
| Compound Name | 5-(4-aminophenyl)-N-cyclopentyl-2-methylpyrimidin-4-amine;6-chloro-N-cyclopentyl-2-methyl-5-(4-nitrophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 160793666 |
| Molecular Formula | C32H37ClN8O2 |
| Molecular Weight | 601.16 g/mol |
| Exact Mass | 600.27 |
| IUPAC Name | 5-(4-aminophenyl)-N-cyclopentyl-2-methylpyrimidin-4-amine;6-chloro-N-cyclopentyl-2-methyl-5-(4-nitrophenyl)pyrimidin-4-amine |
| SMILES | Cc1nc(Cl)c(-c2ccc([N+](=O)[O-])cc2)c(NC2CCCC2)n1.Cc1ncc(-c2ccc(N)cc2)c(NC2CCCC2)n1 |
| InChI | InChI=1S/C16H17ClN4O2.C16H20N4/c1-10-18-15(17)14(11-6-8-13(9-7-11)21(22)23)16(19-10)20-12-4-2-3-5-12;1-11-18-10-15(12-6-8-13(17)9-7-12)16(19-11)20-14-4-2-3-5-14/h6-9,12H,2-5H2,1H3,(H,18,19,20);6-10,14H,2-5,17H2,1H3,(H,18,19,20) |
| InChIKey | SCDPGJBKWTZBEL-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 144.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.16 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|