C23H16N4O2 — CID 58790603
4-(6-nitro-4-phenyl-9H-pyrido[2,3-b]indol-3-yl)aniline (PubChem CID 58790603) has the molecular formula C23H16N4O2 and a molecular weight of 380.41 g/mol. Its IUPAC name is 4-(6-nitro-4-phenyl-9H-pyrido[2,3-b]indol-3-yl)aniline.
| Compound Name | 4-(6-nitro-4-phenyl-9H-pyrido[2,3-b]indol-3-yl)aniline |
|---|---|
| PubChem CID | 58790603 |
| Molecular Formula | C23H16N4O2 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 4-(6-nitro-4-phenyl-9H-pyrido[2,3-b]indol-3-yl)aniline |
| SMILES | Nc1ccc(-c2cnc3[nH]c4ccc([N+](=O)[O-])cc4c3c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H16N4O2/c24-16-8-6-14(7-9-16)19-13-25-23-22(21(19)15-4-2-1-3-5-15)18-12-17(27(28)29)10-11-20(18)26-23/h1-13H,24H2,(H,25,26) |
| InChIKey | SDFOAABMEIWSDE-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|