C25H19N3O2 — CID 58790649
methyl 3-(4-aminophenyl)-4-phenyl-9H-pyrido[2,3-b]indole-6-carboxylate (PubChem CID 58790649) has the molecular formula C25H19N3O2 and a molecular weight of 393.45 g/mol. Its IUPAC name is methyl 3-(4-aminophenyl)-4-phenyl-9H-pyrido[2,3-b]indole-6-carboxylate.
| Compound Name | methyl 3-(4-aminophenyl)-4-phenyl-9H-pyrido[2,3-b]indole-6-carboxylate |
|---|---|
| PubChem CID | 58790649 |
| Molecular Formula | C25H19N3O2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | methyl 3-(4-aminophenyl)-4-phenyl-9H-pyrido[2,3-b]indole-6-carboxylate |
| SMILES | COC(=O)c1ccc2[nH]c3ncc(-c4ccc(N)cc4)c(-c4ccccc4)c3c2c1 |
| InChI | InChI=1S/C25H19N3O2/c1-30-25(29)17-9-12-21-19(13-17)23-22(16-5-3-2-4-6-16)20(14-27-24(23)28-21)15-7-10-18(26)11-8-15/h2-14H,26H2,1H3,(H,27,28) |
| InChIKey | UIZXREWARSBFBV-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|