C28H22N4S2 — CID 143364264
3-(4-aminophenyl)-N-methyl-4-phenyl-N-thiophen-2-ylsulfanyl-9H-pyrido[2,3-b]indol-6-amine (PubChem CID 143364264) has the molecular formula C28H22N4S2 and a molecular weight of 478.65 g/mol. Its IUPAC name is 3-(4-aminophenyl)-N-methyl-4-phenyl-N-thiophen-2-ylsulfanyl-9H-pyrido[2,3-b]indol-6-amine.
| Compound Name | 3-(4-aminophenyl)-N-methyl-4-phenyl-N-thiophen-2-ylsulfanyl-9H-pyrido[2,3-b]indol-6-amine |
|---|---|
| PubChem CID | 143364264 |
| Molecular Formula | C28H22N4S2 |
| Molecular Weight | 478.65 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 3-(4-aminophenyl)-N-methyl-4-phenyl-N-thiophen-2-ylsulfanyl-9H-pyrido[2,3-b]indol-6-amine |
| SMILES | CN(Sc1cccs1)c1ccc2[nH]c3ncc(-c4ccc(N)cc4)c(-c4ccccc4)c3c2c1 |
| InChI | InChI=1S/C28H22N4S2/c1-32(34-25-8-5-15-33-25)21-13-14-24-22(16-21)27-26(19-6-3-2-4-7-19)23(17-30-28(27)31-24)18-9-11-20(29)12-10-18/h2-17H,29H2,1H3,(H,30,31) |
| InChIKey | IOCZRBVZLRNCRC-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.65 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|