C27H19N3O3S2 — CID 58791070
[3-(4-aminophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] thiophene-2-sulfonate (PubChem CID 58791070) has the molecular formula C27H19N3O3S2 and a molecular weight of 497.60 g/mol. Its IUPAC name is [3-(4-aminophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] thiophene-2-sulfonate.
| Compound Name | [3-(4-aminophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] thiophene-2-sulfonate |
|---|---|
| PubChem CID | 58791070 |
| Molecular Formula | C27H19N3O3S2 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | [3-(4-aminophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] thiophene-2-sulfonate |
| SMILES | Nc1ccc(-c2cnc3[nH]c4ccc(OS(=O)(=O)c5cccs5)cc4c3c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H19N3O3S2/c28-19-10-8-17(9-11-19)22-16-29-27-26(25(22)18-5-2-1-3-6-18)21-15-20(12-13-23(21)30-27)33-35(31,32)24-7-4-14-34-24/h1-16H,28H2,(H,29,30) |
| InChIKey | ADHGYRNDAIBMQU-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|