C22H16N2OS — CID 15723652
3-(4-methoxyphenyl)-4-thiophen-2-yl-9H-pyrido[2,3-b]indole (PubChem CID 15723652) has the molecular formula C22H16N2OS and a molecular weight of 356.45 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-4-thiophen-2-yl-9H-pyrido[2,3-b]indole.
| Compound Name | 3-(4-methoxyphenyl)-4-thiophen-2-yl-9H-pyrido[2,3-b]indole |
|---|---|
| PubChem CID | 15723652 |
| Molecular Formula | C22H16N2OS |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 3-(4-methoxyphenyl)-4-thiophen-2-yl-9H-pyrido[2,3-b]indole |
| SMILES | COc1ccc(-c2cnc3[nH]c4ccccc4c3c2-c2cccs2)cc1 |
| InChI | InChI=1S/C22H16N2OS/c1-25-15-10-8-14(9-11-15)17-13-23-22-21(20(17)19-7-4-12-26-19)16-5-2-3-6-18(16)24-22/h2-13H,1H3,(H,23,24) |
| InChIKey | NCMZCPNFKIHMCX-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |