C17H13N3OS — CID 23025793
2-(phenoxymethyl)-6-thiophen-2-yl-1H-imidazo[4,5-b]pyridine (PubChem CID 23025793) has the molecular formula C17H13N3OS and a molecular weight of 307.38 g/mol. Its IUPAC name is 2-(phenoxymethyl)-6-thiophen-2-yl-1H-imidazo[4,5-b]pyridine.
| Compound Name | 2-(phenoxymethyl)-6-thiophen-2-yl-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 23025793 |
| Molecular Formula | C17H13N3OS |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 2-(phenoxymethyl)-6-thiophen-2-yl-1H-imidazo[4,5-b]pyridine |
| SMILES | c1ccc(OCc2nc3ncc(-c4cccs4)cc3[nH]2)cc1 |
| InChI | InChI=1S/C17H13N3OS/c1-2-5-13(6-3-1)21-11-16-19-14-9-12(10-18-17(14)20-16)15-7-4-8-22-15/h1-10H,11H2,(H,18,19,20) |
| InChIKey | VNODMTYMZKDPGU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |