C15H13N3O2 — CID 4915421
methyl 2-(4-aminophenyl)-3H-benzimidazole-5-carboxylate (PubChem CID 4915421) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is methyl 2-(4-aminophenyl)-3H-benzimidazole-5-carboxylate.
| Compound Name | methyl 2-(4-aminophenyl)-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 4915421 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | methyl 2-(4-aminophenyl)-3H-benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2nc(-c3ccc(N)cc3)[nH]c2c1 |
| InChI | InChI=1S/C15H13N3O2/c1-20-15(19)10-4-7-12-13(8-10)18-14(17-12)9-2-5-11(16)6-3-9/h2-8H,16H2,1H3,(H,17,18) |
| InChIKey | DNHHMXVALPQQRQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|