C17H20N2O5 — CID 134694491
ethyl 2-(4-methoxyphenyl)-3H-benzimidazole-5-carboxylate;dihydrate (PubChem CID 134694491) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is ethyl 2-(4-methoxyphenyl)-3H-benzimidazole-5-carboxylate;dihydrate.
| Compound Name | ethyl 2-(4-methoxyphenyl)-3H-benzimidazole-5-carboxylate;dihydrate |
|---|---|
| PubChem CID | 134694491 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | ethyl 2-(4-methoxyphenyl)-3H-benzimidazole-5-carboxylate;dihydrate |
| SMILES | CCOC(=O)c1ccc2nc(-c3ccc(OC)cc3)[nH]c2c1.O.O |
| InChI | InChI=1S/C17H16N2O3.2H2O/c1-3-22-17(20)12-6-9-14-15(10-12)19-16(18-14)11-4-7-13(21-2)8-5-11;;/h4-10H,3H2,1-2H3,(H,18,19);2*1H2 |
| InChIKey | KJZQIBCODCQWEZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 127.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |