C22H17N3O4 — CID 23831665
(2-oxo-2-pyridin-4-ylethyl) 2-(4-methoxyphenyl)-3H-benzimidazole-5-carboxylate (PubChem CID 23831665) has the molecular formula C22H17N3O4 and a molecular weight of 387.40 g/mol. Its IUPAC name is (2-oxo-2-pyridin-4-ylethyl) 2-(4-methoxyphenyl)-3H-benzimidazole-5-carboxylate.
| Compound Name | (2-oxo-2-pyridin-4-ylethyl) 2-(4-methoxyphenyl)-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 23831665 |
| Molecular Formula | C22H17N3O4 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | (2-oxo-2-pyridin-4-ylethyl) 2-(4-methoxyphenyl)-3H-benzimidazole-5-carboxylate |
| SMILES | COc1ccc(-c2nc3ccc(C(=O)OCC(=O)c4ccncc4)cc3[nH]2)cc1 |
| InChI | InChI=1S/C22H17N3O4/c1-28-17-5-2-15(3-6-17)21-24-18-7-4-16(12-19(18)25-21)22(27)29-13-20(26)14-8-10-23-11-9-14/h2-12H,13H2,1H3,(H,24,25) |
| InChIKey | RCLMYOMJDIJUMH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |