C22H18N4O4 — CID 23744366
[2-oxo-2-(pyridin-4-ylamino)ethyl] 2-(4-methoxyphenyl)-3H-benzimidazole-5-carboxylate (PubChem CID 23744366) has the molecular formula C22H18N4O4 and a molecular weight of 402.41 g/mol. Its IUPAC name is [2-oxo-2-(pyridin-4-ylamino)ethyl] 2-(4-methoxyphenyl)-3H-benzimidazole-5-carboxylate.
| Compound Name | [2-oxo-2-(pyridin-4-ylamino)ethyl] 2-(4-methoxyphenyl)-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 23744366 |
| Molecular Formula | C22H18N4O4 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | [2-oxo-2-(pyridin-4-ylamino)ethyl] 2-(4-methoxyphenyl)-3H-benzimidazole-5-carboxylate |
| SMILES | COc1ccc(-c2nc3ccc(C(=O)OCC(=O)Nc4ccncc4)cc3[nH]2)cc1 |
| InChI | InChI=1S/C22H18N4O4/c1-29-17-5-2-14(3-6-17)21-25-18-7-4-15(12-19(18)26-21)22(28)30-13-20(27)24-16-8-10-23-11-9-16/h2-12H,13H2,1H3,(H,25,26)(H,23,24,27) |
| InChIKey | NEWWECYREDIRQU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |