C24H21N3O4 — CID 23744300
[2-(4-methylanilino)-2-oxoethyl] 2-(4-methoxyphenyl)-3H-benzimidazole-5-carboxylate (PubChem CID 23744300) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is [2-(4-methylanilino)-2-oxoethyl] 2-(4-methoxyphenyl)-3H-benzimidazole-5-carboxylate.
| Compound Name | [2-(4-methylanilino)-2-oxoethyl] 2-(4-methoxyphenyl)-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 23744300 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | [2-(4-methylanilino)-2-oxoethyl] 2-(4-methoxyphenyl)-3H-benzimidazole-5-carboxylate |
| SMILES | COc1ccc(-c2nc3ccc(C(=O)OCC(=O)Nc4ccc(C)cc4)cc3[nH]2)cc1 |
| InChI | InChI=1S/C24H21N3O4/c1-15-3-8-18(9-4-15)25-22(28)14-31-24(29)17-7-12-20-21(13-17)27-23(26-20)16-5-10-19(30-2)11-6-16/h3-13H,14H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | UVDLYPZIXLWNID-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |