C24H21N3O5 — CID 23943546
[2-(2,4-dimethoxyanilino)-2-oxoethyl] 2-phenyl-3H-benzimidazole-5-carboxylate (PubChem CID 23943546) has the molecular formula C24H21N3O5 and a molecular weight of 431.45 g/mol. Its IUPAC name is [2-(2,4-dimethoxyanilino)-2-oxoethyl] 2-phenyl-3H-benzimidazole-5-carboxylate.
| Compound Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] 2-phenyl-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 23943546 |
| Molecular Formula | C24H21N3O5 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] 2-phenyl-3H-benzimidazole-5-carboxylate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2ccc3nc(-c4ccccc4)[nH]c3c2)c(OC)c1 |
| InChI | InChI=1S/C24H21N3O5/c1-30-17-9-11-19(21(13-17)31-2)25-22(28)14-32-24(29)16-8-10-18-20(12-16)27-23(26-18)15-6-4-3-5-7-15/h3-13H,14H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | DQPJXQNGGPPEHD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 102.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |