C15H12N2O4 — CID 136663209
methyl 2-(3,4-dihydroxyphenyl)-3H-benzimidazole-5-carboxylate (PubChem CID 136663209) has the molecular formula C15H12N2O4 and a molecular weight of 284.27 g/mol. Its IUPAC name is methyl 2-(3,4-dihydroxyphenyl)-3H-benzimidazole-5-carboxylate.
| Compound Name | methyl 2-(3,4-dihydroxyphenyl)-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 136663209 |
| Molecular Formula | C15H12N2O4 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | methyl 2-(3,4-dihydroxyphenyl)-3H-benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2nc(-c3ccc(O)c(O)c3)[nH]c2c1 |
| InChI | InChI=1S/C15H12N2O4/c1-21-15(20)9-2-4-10-11(6-9)17-14(16-10)8-3-5-12(18)13(19)7-8/h2-7,18-19H,1H3,(H,16,17) |
| InChIKey | CBEBEGQTWLXGRQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 95.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|