C17H17ClN4O2 — CID 23085771
methyl 4-[6-(1-aminoethylideneamino)-1H-benzimidazol-2-yl]benzoate;hydrochloride (PubChem CID 23085771) has the molecular formula C17H17ClN4O2 and a molecular weight of 344.80 g/mol. Its IUPAC name is methyl 4-[6-(1-aminoethylideneamino)-1H-benzimidazol-2-yl]benzoate;hydrochloride.
| Compound Name | methyl 4-[6-(1-aminoethylideneamino)-1H-benzimidazol-2-yl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 23085771 |
| Molecular Formula | C17H17ClN4O2 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | methyl 4-[6-(1-aminoethylideneamino)-1H-benzimidazol-2-yl]benzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(-c2nc3ccc(/N=C(\C)N)cc3[nH]2)cc1.Cl |
| InChI | InChI=1S/C17H16N4O2.ClH/c1-10(18)19-13-7-8-14-15(9-13)21-16(20-14)11-3-5-12(6-4-11)17(22)23-2;/h3-9H,1-2H3,(H2,18,19)(H,20,21);1H |
| InChIKey | RUAURFPXLNYAHT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|