C24H22N4O3 — CID 3568302
methyl 4-[[2-[4-(dimethylamino)phenyl]-3H-benzimidazol-5-yl]carbamoyl]benzoate (PubChem CID 3568302) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is methyl 4-[[2-[4-(dimethylamino)phenyl]-3H-benzimidazol-5-yl]carbamoyl]benzoate.
| Compound Name | methyl 4-[[2-[4-(dimethylamino)phenyl]-3H-benzimidazol-5-yl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 3568302 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | methyl 4-[[2-[4-(dimethylamino)phenyl]-3H-benzimidazol-5-yl]carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)Nc2ccc3nc(-c4ccc(N(C)C)cc4)[nH]c3c2)cc1 |
| InChI | InChI=1S/C24H22N4O3/c1-28(2)19-11-8-15(9-12-19)22-26-20-13-10-18(14-21(20)27-22)25-23(29)16-4-6-17(7-5-16)24(30)31-3/h4-14H,1-3H3,(H,25,29)(H,26,27) |
| InChIKey | JYOMIOOWYUUSHQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|