C31H30N6O2 — CID 67112793
N-[4-[[4-(dimethylamino)benzoyl]amino]phenyl]-2-[4-(dimethylamino)phenyl]-3H-benzimidazole-5-carboxamide (PubChem CID 67112793) has the molecular formula C31H30N6O2 and a molecular weight of 518.62 g/mol. Its IUPAC name is N-[4-[[4-(dimethylamino)benzoyl]amino]phenyl]-2-[4-(dimethylamino)phenyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[4-[[4-(dimethylamino)benzoyl]amino]phenyl]-2-[4-(dimethylamino)phenyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 67112793 |
| Molecular Formula | C31H30N6O2 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | N-[4-[[4-(dimethylamino)benzoyl]amino]phenyl]-2-[4-(dimethylamino)phenyl]-3H-benzimidazole-5-carboxamide |
| SMILES | CN(C)c1ccc(C(=O)Nc2ccc(NC(=O)c3ccc4nc(-c5ccc(N(C)C)cc5)[nH]c4c3)cc2)cc1 |
| InChI | InChI=1S/C31H30N6O2/c1-36(2)25-14-5-20(6-15-25)29-34-27-18-9-22(19-28(27)35-29)31(39)33-24-12-10-23(11-13-24)32-30(38)21-7-16-26(17-8-21)37(3)4/h5-19H,1-4H3,(H,32,38)(H,33,39)(H,34,35) |
| InChIKey | RVBMOTQHEUFWBC-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|