C43H37ClN8O3 — CID 164997337
2-(4-aminophenyl)-N-(3-methoxyphenyl)-3H-benzimidazole-5-carboxamide;N-(4-chlorophenyl)-2-[4-(dimethylamino)phenyl]-3H-benzimidazole-5-carboxamide (PubChem CID 164997337) has the molecular formula C43H37ClN8O3 and a molecular weight of 749.28 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-(3-methoxyphenyl)-3H-benzimidazole-5-carboxamide;N-(4-chlorophenyl)-2-[4-(dimethylamino)phenyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-(4-aminophenyl)-N-(3-methoxyphenyl)-3H-benzimidazole-5-carboxamide;N-(4-chlorophenyl)-2-[4-(dimethylamino)phenyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 164997337 |
| Molecular Formula | C43H37ClN8O3 |
| Molecular Weight | 749.28 g/mol |
| Exact Mass | 748.27 |
| IUPAC Name | 2-(4-aminophenyl)-N-(3-methoxyphenyl)-3H-benzimidazole-5-carboxamide;N-(4-chlorophenyl)-2-[4-(dimethylamino)phenyl]-3H-benzimidazole-5-carboxamide |
| SMILES | CN(C)c1ccc(-c2nc3ccc(C(=O)Nc4ccc(Cl)cc4)cc3[nH]2)cc1.COc1cccc(NC(=O)c2ccc3nc(-c4ccc(N)cc4)[nH]c3c2)c1 |
| InChI | InChI=1S/C22H19ClN4O.C21H18N4O2/c1-27(2)18-10-3-14(4-11-18)21-25-19-12-5-15(13-20(19)26-21)22(28)24-17-8-6-16(23)7-9-17;1-27-17-4-2-3-16(12-17)23-21(26)14-7-10-18-19(11-14)25-20(24-18)13-5-8-15(22)9-6-13/h3-13H,1-2H3,(H,24,28)(H,25,26);2-12H,22H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | HSXXRAIABNEDIV-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 154.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.28 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|