C22H21N5O2 — CID 134373088
2-[4-(dimethylamino)phenyl]-N-(6-methoxy-3-pyridinyl)-3H-benzimidazole-5-carboxamide (PubChem CID 134373088) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenyl]-N-(6-methoxy-3-pyridinyl)-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-[4-(dimethylamino)phenyl]-N-(6-methoxy-3-pyridinyl)-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 134373088 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]-N-(6-methoxy-3-pyridinyl)-3H-benzimidazole-5-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc3nc(-c4ccc(N(C)C)cc4)[nH]c3c2)cn1 |
| InChI | InChI=1S/C22H21N5O2/c1-27(2)17-8-4-14(5-9-17)21-25-18-10-6-15(12-19(18)26-21)22(28)24-16-7-11-20(29-3)23-13-16/h4-13H,1-3H3,(H,24,28)(H,25,26) |
| InChIKey | KNOQKFKILLZESZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|