C29H26N4O — CID 67686397
N-[2-(4-benzylphenyl)-3H-benzimidazol-5-yl]-4-(dimethylamino)benzamide (PubChem CID 67686397) has the molecular formula C29H26N4O and a molecular weight of 446.55 g/mol. Its IUPAC name is N-[2-(4-benzylphenyl)-3H-benzimidazol-5-yl]-4-(dimethylamino)benzamide.
| Compound Name | N-[2-(4-benzylphenyl)-3H-benzimidazol-5-yl]-4-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 67686397 |
| Molecular Formula | C29H26N4O |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | N-[2-(4-benzylphenyl)-3H-benzimidazol-5-yl]-4-(dimethylamino)benzamide |
| SMILES | CN(C)c1ccc(C(=O)Nc2ccc3nc(-c4ccc(Cc5ccccc5)cc4)[nH]c3c2)cc1 |
| InChI | InChI=1S/C29H26N4O/c1-33(2)25-15-12-23(13-16-25)29(34)30-24-14-17-26-27(19-24)32-28(31-26)22-10-8-21(9-11-22)18-20-6-4-3-5-7-20/h3-17,19H,18H2,1-2H3,(H,30,34)(H,31,32) |
| InChIKey | RZVBKIUSXHFHCH-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |