C31H30N4O2 — CID 142812938
ethane;3-methyl-N-[4-[6-[(3-methylbenzoyl)amino]-1H-benzimidazol-2-yl]phenyl]benzamide (PubChem CID 142812938) has the molecular formula C31H30N4O2 and a molecular weight of 490.61 g/mol. Its IUPAC name is ethane;3-methyl-N-[4-[6-[(3-methylbenzoyl)amino]-1H-benzimidazol-2-yl]phenyl]benzamide.
| Compound Name | ethane;3-methyl-N-[4-[6-[(3-methylbenzoyl)amino]-1H-benzimidazol-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 142812938 |
| Molecular Formula | C31H30N4O2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | ethane;3-methyl-N-[4-[6-[(3-methylbenzoyl)amino]-1H-benzimidazol-2-yl]phenyl]benzamide |
| SMILES | CC.Cc1cccc(C(=O)Nc2ccc(-c3nc4ccc(NC(=O)c5cccc(C)c5)cc4[nH]3)cc2)c1 |
| InChI | InChI=1S/C29H24N4O2.C2H6/c1-18-5-3-7-21(15-18)28(34)30-23-11-9-20(10-12-23)27-32-25-14-13-24(17-26(25)33-27)31-29(35)22-8-4-6-19(2)16-22;1-2/h3-17H,1-2H3,(H,30,34)(H,31,35)(H,32,33);1-2H3 |
| InChIKey | GZJFDXLZKKBJJG-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |