C22H16N6O2 — CID 142169440
4-[[2-(4-methylphenyl)-3H-benzimidazole-5-carbonyl]amino]benzoyl azide (PubChem CID 142169440) has the molecular formula C22H16N6O2 and a molecular weight of 396.41 g/mol. Its IUPAC name is 4-[[2-(4-methylphenyl)-3H-benzimidazole-5-carbonyl]amino]benzoyl azide.
| Compound Name | 4-[[2-(4-methylphenyl)-3H-benzimidazole-5-carbonyl]amino]benzoyl azide |
|---|---|
| PubChem CID | 142169440 |
| Molecular Formula | C22H16N6O2 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 4-[[2-(4-methylphenyl)-3H-benzimidazole-5-carbonyl]amino]benzoyl azide |
| SMILES | Cc1ccc(-c2nc3ccc(C(=O)Nc4ccc(C(=O)N=[N+]=[N-])cc4)cc3[nH]2)cc1 |
| InChI | InChI=1S/C22H16N6O2/c1-13-2-4-14(5-3-13)20-25-18-11-8-16(12-19(18)26-20)21(29)24-17-9-6-15(7-10-17)22(30)27-28-23/h2-12H,1H3,(H,24,29)(H,25,26) |
| InChIKey | DGMCMDHPKMHZDX-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 123.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|