C16H15N7O2 — CID 168602752
2-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]-3H-benzimidazole-5-carboxylic acid (PubChem CID 168602752) has the molecular formula C16H15N7O2 and a molecular weight of 337.34 g/mol. Its IUPAC name is 2-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]-3H-benzimidazole-5-carboxylic acid.
| Compound Name | 2-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]-3H-benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 168602752 |
| Molecular Formula | C16H15N7O2 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 2-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]-3H-benzimidazole-5-carboxylic acid |
| SMILES | NC(N)=N/C(N)=N/c1ccc(-c2nc3ccc(C(=O)O)cc3[nH]2)cc1 |
| InChI | InChI=1S/C16H15N7O2/c17-15(18)23-16(19)20-10-4-1-8(2-5-10)13-21-11-6-3-9(14(24)25)7-12(11)22-13/h1-7H,(H,21,22)(H,24,25)(H6,17,18,19,20,23) |
| InChIKey | MKMXXJQCAGTPDZ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 168.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|