2-(4-hydroxyphenyl)-3H-benzimidazole-5-carboxylic acid

C28H20N4O6 — CID 162148176

IUPAC2-(4-hydroxyphenyl)-3H-benzimidazole-5-carboxylic acid
SMILESO=C(O)c1ccc2nc(-c3ccc(O)cc3)[nH]c2c1.O=C(O)c1ccc2nc(-c3ccc(O)cc3)[nH]c2c1
InChIInChI=1S/2C14H10N2O3/c2*17-10-4-1-8(2-5-10)13-15-11-6-3-9(14(18)19)7-12(11)16-13/h2*1-7,17H,(H,15,16)(H,18,19)
InChIKeyZKVOQSBYPWZRQI-UHFFFAOYSA-N
MW508.49 g/mol
LogP5.27
Rot. Bonds4

About 2-(4-hydroxyphenyl)-3H-benzimidazole-5-carboxylic acid

2-(4-hydroxyphenyl)-3H-benzimidazole-5-carboxylic acid (PubChem CID 162148176) has the molecular formula C28H20N4O6 and a molecular weight of 508.49 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-3H-benzimidazole-5-carboxylic acid.

Molecular Properties

Compound Name2-(4-hydroxyphenyl)-3H-benzimidazole-5-carboxylic acid
PubChem CID162148176
Molecular FormulaC28H20N4O6
Molecular Weight508.49 g/mol
Exact Mass508.14
IUPAC Name2-(4-hydroxyphenyl)-3H-benzimidazole-5-carboxylic acid
SMILESO=C(O)c1ccc2nc(-c3ccc(O)cc3)[nH]c2c1.O=C(O)c1ccc2nc(-c3ccc(O)cc3)[nH]c2c1
InChIInChI=1S/2C14H10N2O3/c2*17-10-4-1-8(2-5-10)13-15-11-6-3-9(14(18)19)7-12(11)16-13/h2*1-7,17H,(H,15,16)(H,18,19)
InChIKeyZKVOQSBYPWZRQI-UHFFFAOYSA-N
XLogP5.27
TPSA172.42 Ų
H-Bond Donors6
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms38
Complexity—

Lipinski Rule of Five

3 violations

RuleValue
MW ≤ 500508.49
LogP ≤ 55.27
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 106

Analyze 2-(4-hydroxyphenyl)-3H-benzimidazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-hydroxyphenyl)-3H-benzimidazole-5-carboxylic acid?
The IUPAC name of 2-(4-hydroxyphenyl)-3H-benzimidazole-5-carboxylic acid (CID 162148176) is 2-(4-hydroxyphenyl)-3H-benzimidazole-5-carboxylic acid.
What is the SMILES notation for 2-(4-hydroxyphenyl)-3H-benzimidazole-5-carboxylic acid?
The canonical SMILES for 2-(4-hydroxyphenyl)-3H-benzimidazole-5-carboxylic acid is O=C(O)c1ccc2nc(-c3ccc(O)cc3)[nH]c2c1.O=C(O)c1ccc2nc(-c3ccc(O)cc3)[nH]c2c1.
What is the InChIKey of 2-(4-hydroxyphenyl)-3H-benzimidazole-5-carboxylic acid?
The InChIKey is ZKVOQSBYPWZRQI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C14H10N2O3/c2*17-10-4-1-8(2-5-10)13-15-11-6-3-9(14(18)19)7-12(11)16-13/h2*1-7,17H,(H,15,16)(H,18,19).
What are the key properties of 2-(4-hydroxyphenyl)-3H-benzimidazole-5-carboxylic acid?
2-(4-hydroxyphenyl)-3H-benzimidazole-5-carboxylic acid has a molecular weight of 508.49 g/mol, XLogP of 5.27, 4 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxyphenyl)-3H-benzimidazole-5-carboxylic acid is sourced from PubChem (CID 162148176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).