C27H18N4O — CID 174583837
bis(2-phenyl-3H-benzimidazol-5-yl)methanone (PubChem CID 174583837) has the molecular formula C27H18N4O and a molecular weight of 414.47 g/mol. Its IUPAC name is bis(2-phenyl-3H-benzimidazol-5-yl)methanone.
| Compound Name | bis(2-phenyl-3H-benzimidazol-5-yl)methanone |
|---|---|
| PubChem CID | 174583837 |
| Molecular Formula | C27H18N4O |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | bis(2-phenyl-3H-benzimidazol-5-yl)methanone |
| SMILES | O=C(c1ccc2nc(-c3ccccc3)[nH]c2c1)c1ccc2nc(-c3ccccc3)[nH]c2c1 |
| InChI | InChI=1S/C27H18N4O/c32-25(19-11-13-21-23(15-19)30-26(28-21)17-7-3-1-4-8-17)20-12-14-22-24(16-20)31-27(29-22)18-9-5-2-6-10-18/h1-16H,(H,28,30)(H,29,31) |
| InChIKey | WUPSDSHIRSYBSR-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |