C18H18N4O2 — CID 110766096
N-(2-acetamidoethyl)-2-phenyl-3H-benzimidazole-5-carboxamide (PubChem CID 110766096) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-2-phenyl-3H-benzimidazole-5-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-2-phenyl-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 110766096 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | N-(2-acetamidoethyl)-2-phenyl-3H-benzimidazole-5-carboxamide |
| SMILES | CC(=O)NCCNC(=O)c1ccc2nc(-c3ccccc3)[nH]c2c1 |
| InChI | InChI=1S/C18H18N4O2/c1-12(23)19-9-10-20-18(24)14-7-8-15-16(11-14)22-17(21-15)13-5-3-2-4-6-13/h2-8,11H,9-10H2,1H3,(H,19,23)(H,20,24)(H,21,22) |
| InChIKey | QTSPKLURNRTOCP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|