C26H26N6O — CID 14903288
N-[3-(dimethylamino)propyl]-2-(2-phenyl-3H-benzimidazol-5-yl)-3H-benzimidazole-5-carboxamide (PubChem CID 14903288) has the molecular formula C26H26N6O and a molecular weight of 438.54 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-(2-phenyl-3H-benzimidazol-5-yl)-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2-(2-phenyl-3H-benzimidazol-5-yl)-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 14903288 |
| Molecular Formula | C26H26N6O |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-(2-phenyl-3H-benzimidazol-5-yl)-3H-benzimidazole-5-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1ccc2nc(-c3ccc4nc(-c5ccccc5)[nH]c4c3)[nH]c2c1 |
| InChI | InChI=1S/C26H26N6O/c1-32(2)14-6-13-27-26(33)19-10-12-21-23(16-19)31-25(29-21)18-9-11-20-22(15-18)30-24(28-20)17-7-4-3-5-8-17/h3-5,7-12,15-16H,6,13-14H2,1-2H3,(H,27,33)(H,28,30)(H,29,31) |
| InChIKey | BTZHPSBDHORDOX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|